Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-11-19 15:41:17 UTC
Update Date2025-10-07 16:08:05 UTC
Metabolite IDMMDBc0047758
Metabolite Identification
Common Namealpha-Calacorene
Descriptionalpha-Calacorene is a sesquiterpene, a class of organic compounds characterized by their three isoprene units. Its chemical structure features a complex arrangement of carbon atoms, typically comprising a bicyclic framework that contributes to its diverse biological activities. In terms of its biosynthetic pathways, alpha-Calacorene is synthesized through the mevalonate pathway, which is a crucial metabolic route for terpenoid production in plants. This compound has been identified in various studies, including one where LC-MS/MS analysis revealed its presence alongside other metabolites such as daidzein, germicidin, and staurosporine, highlighting its potential antibacterial and anticancer effects (PMID:40153994 ). The structural characteristics of alpha-Calacorene may facilitate interactions with biological targets, thereby influencing cellular processes and contributing to its pharmacological properties. Overall, alpha-Calacorene exemplifies the complex interplay between plant secondary metabolites and their roles in biological systems, underscoring its significance in both chemistry and potential therapeutic applications.
Structure
SynonymsNot Available
Molecular FormulaC15H20
Average Mass200.325
Monoisotopic Mass200.156500644
IUPAC NameNot Available
Traditional NameNot Available
CAS Registry NumberNot Available
SMILESNot Available
InChI Identifier
InChI=1S/C15H20/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h5-7,9-10,13H,8H2,1-4H3/t13-/m0/s1
InChI KeyCUUMXRBKJIDIAY-ZDUSSCGKSA-N