Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-04-29 21:54:27 UTC
Update Date2025-10-07 16:08:11 UTC
Metabolite IDMMDBc0048236
Metabolite Identification
Common NameTrans,Trans,Cis-Geranylgeranyl Diphosphate
DescriptionTrans,Trans,Cis-Geranylgeranyl Diphosphate is a polyisoprenoid compound belonging to the class of diphosphate esters. Its chemical structure features a long hydrocarbon chain derived from isoprene units, specifically consisting of a geranylgeranyl moiety with a unique trans,trans,cis configuration. This compound plays a crucial role in various biochemical pathways, particularly in the post-translational modification of proteins through prenylation, which facilitates the attachment of proteins to cell membranes, influencing their localization and function. It is involved in the biosynthesis of isoprenoids and serves as a precursor for the synthesis of other important molecules, including carotenoids and certain hormones. Additionally, trans,trans,cis-geranylgeranyl diphosphate is associated with the metabolism of long-chain polyprenyl diphosphates, highlighting its significance in cellular processes (PMID:1527001 ). Its unique structural characteristics and involvement in essential metabolic pathways underscore its importance in both chemistry and biology.
Structure
Synonyms
ValueSource
(2Z,6E,10E)-Geranylgeranyl diphosphateChEBI
Di-trans,poly-cis-geranylgeranyl diphosphateChEBI
(2Z,6E,10E)-Geranylgeranyl diphosphoric acidGenerator
Di-trans,poly-cis-geranylgeranyl diphosphoric acidGenerator
Omega,e,e,Z-geranylgeranyl diphosphoric acidGenerator
Molecular FormulaC20H33O7P2
Average Mass447.426
Monoisotopic Mass447.171798138
IUPAC Name{[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl phosphono]oxy}phosphonate
Traditional Name[(2Z,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl phosphono]oxyphosphonate
CAS Registry NumberNot Available
SMILES
[H]C(=C(C([H])([H])[H])C([H])([H])[H])C([H])([H])C([H])([H])C(=C(/[H])C([H])([H])C([H])([H])C(=C(/[H])C([H])([H])C([H])([H])C(=C(\[H])C([H])([H])OP([O-])(=O)OP([O-])([O-])=O)\C([H])([H])[H])\C([H])([H])[H])\C([H])([H])[H]
InChI Identifier
InChI=1S/C20H36O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/p-3/b18-11+,19-13+,20-15-
InChI KeyOINNEUNVOZHBOX-KWBDAJKESA-K