Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-04-29 22:44:46 UTC
Update Date2025-10-07 16:08:13 UTC
Metabolite IDMMDBc0049851
Metabolite Identification
Common NamePrecorrin 3B
DescriptionPrecorrin 3B is a tetrapyrrole compound that belongs to the chemical class of corrinoids. It plays a crucial role in the biosynthetic pathway of vitamin B12, serving as a key intermediate in the transformation processes that lead to the formation of this essential cofactor. The chemical structure of precorrin 3B consists of a series of interconnected pyrrole rings, which are characteristic of tetrapyrroles, and it features specific functional groups that facilitate its reactivity and interaction with enzymes involved in vitamin B12 synthesis. Precorrin 3B is synthesized from earlier precursors in the pathway, and its conversion to precorrin-4 is a critical step that further leads to the production of vitamin B12. The study of precorrin 3B and its derivatives has provided insights into the enzymatic mechanisms underlying corrinoid biosynthesis, highlighting the importance of these metabolites in cellular processes and their potential implications in understanding vitamin B12-related disorders (PMID:9224567 ).
Structure
Synonyms
ValueSource
Precorrin 3bChEBI
Molecular FormulaC43H50N4O17
Average Mass894.884
Monoisotopic Mass894.317096166
IUPAC Name3-[(1R,2S,14S,15S,19S,20S)-5,9,14-tris(2-carboxyethyl)-4,10,15-tris(carboxymethyl)-2-hydroxy-2,15,20-trimethyl-22-oxo-23-oxa-24,25,26,27-tetraazahexacyclo[16.5.1.1³,⁶.1⁸,¹¹.1¹³,¹⁶.0¹,²⁰]heptacosa-3,5,8,10,12,16(25),17-heptaen-19-yl]propanoic acid
Traditional Name3-[(1R,2S,14S,15S,19S,20S)-5,9,14-tris(2-carboxyethyl)-4,10,15-tris(carboxymethyl)-2-hydroxy-2,15,20-trimethyl-22-oxo-23-oxa-24,25,26,27-tetraazahexacyclo[16.5.1.1³,⁶.1⁸,¹¹.1¹³,¹⁶.0¹,²⁰]heptacosa-3,5,8,10,12,16(25),17-heptaen-19-yl]propanoic acid
CAS Registry NumberNot Available
SMILES
C[C@]1(CC(O)=O)[C@H](CCC(O)=O)\C2=C\C3=C(CC(O)=O)C(CCC(O)=O)=C(CC4=C(CCC(O)=O)C(CC(O)=O)=C(N4)[C@](C)(O)[C@@]45N\C(=C/C1=N2)[C@@H](CCC(O)=O)[C@]4(C)CC(=O)O5)N3
InChI Identifier
InChI=1S/C43H50N4O17/c1-40(17-37(60)61)23(6-10-33(52)53)28-15-27-21(12-35(56)57)19(4-8-31(48)49)25(44-27)14-26-20(5-9-32(50)51)22(13-36(58)59)39(46-26)42(3,63)43-41(2,18-38(62)64-43)24(7-11-34(54)55)29(47-43)16-30(40)45-28/h15-16,23-24,44,46-47,63H,4-14,17-18H2,1-3H3,(H,48,49)(H,50,51)(H,52,53)(H,54,55)(H,56,57)(H,58,59)(H,60,61)/b28-15-,29-16-/t23-,24-,40+,41+,42+,43-/m1/s1
InChI KeyKJHZYYJBHKAUHS-NXWQJPGNSA-N