Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-05-16 21:23:03 UTC
Update Date2025-10-07 16:08:19 UTC
Metabolite IDMMDBc0053394
Metabolite Identification
Common NameKanosamine 6-phosphate
DescriptionKanosamine 6-phosphate is a phosphorylated amino sugar belonging to the class of metabolites known as aminophosphates. Its chemical structure features a six-membered ring with an amino group and a phosphate group, which plays a crucial role in various biochemical pathways. Kanosamine 6-phosphate is generated through the action of the enzyme KabA, which utilizes l-glutamate as the amino donor in a PLP-dependent reaction, marking it as a key intermediate in the biosynthesis of aminoglycosides (PMID:33984505 ). Additionally, the enzyme NtdA from Bacillus subtilis catalyzes the transamination of 3-oxo-α-D-glucose 6-phosphate to produce α-D-kanosamine 6-phosphate, highlighting its importance in carbohydrate metabolism (PMID:24097983 ). Structural studies have revealed the formation of an external aldimine during the interaction of NtdA with kanosamine 6-phosphate, emphasizing its mechanistic role (PMID:24097983 ). Furthermore, kanosamine 6-phosphate is implicated in the early stages of the aminoshikimate pathway, where it is converted into other bioactive compounds (PMID:12207505 ). Overall, kanosamine 6-phosphate serves as a significant metabolic intermediate in various enzymatic processes.
Structure
Synonyms
ValueSource
3-Amino-3-deoxy-D-glucose 6-phosphateChEBI
D-Kanosamine 6-phosphateChEBI
Kanosamine 6-phosphateChEBI
3-Amino-3-deoxy-D-glucose 6-phosphoric acidGenerator
D-Kanosamine 6-phosphoric acidGenerator
Kanosamine 6-phosphoric acidGenerator
Molecular FormulaC6H14NO8P
Average Mass259.151
Monoisotopic Mass259.045703413
IUPAC Name{[(2R,3S,4S,5R)-4-amino-3,5,6-trihydroxyoxan-2-yl]methoxy}phosphonic acid
Traditional Namekanosamine 6-phosphate
CAS Registry NumberNot Available
SMILES
N[C@@H]1[C@@H](O)C(O)O[C@H](COP(O)(O)=O)[C@H]1O
InChI Identifier
InChI=1S/C6H14NO8P/c7-3-4(8)2(1-14-16(11,12)13)15-6(10)5(3)9/h2-6,8-10H,1,7H2,(H2,11,12,13)/t2-,3+,4-,5-,6?/m1/s1
InChI KeyFNLHPZUNSZDBLN-CBPJZXOFSA-N