Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:01:01 UTC
Update Date2025-10-07 16:08:26 UTC
Metabolite IDMMDBc0054237
Metabolite Identification
Common Name3-phenylpropanoic acid
Description3-phenylpropanoic acid is a member of the carboxylic acid chemical class, characterized by its phenyl group attached to a three-carbon propanoic acid chain. This compound features a simple aliphatic structure with a carboxylic acid functional group (-COOH) and a phenyl ring, making it an important intermediate in organic synthesis and metabolic pathways. It is involved in various biochemical processes, including the metabolism of phenolic acids, where key metabolites like 2-hydroxy-3-phenylpropanoic acid and 3-(4-hydroxyphenyl)-propionic acid are noted for their growth-inhibitory effects on certain bacteria (PMID:40224330 ). Additionally, 3-phenylpropanoic acid has been utilized in palladium-catalyzed reactions for regioselective meta-C-H homo-biaryl coupling, highlighting its significance in synthetic organic chemistry (PMID:40526837 ). The compound also participates in the formation of Schiff base compounds when reacted with furfural, demonstrating its reactivity and potential applications in chemical synthesis (PMID:40142032 ). Furthermore, derivatives of 3-phenylpropanoic acid have been explored for their anti-inflammatory and immunomodulatory properties (PMID:40868254 ), indicating its relevance in pharmacological research.
Structure
Synonyms
ValueSource
3-Phenyl propionateChEBI
3-PhenylpropanoateChEBI
3-Phenyl propionic acidGenerator
3-Phenylpropanoic acidGenerator
3-Phenylpropionic acidGenerator
3-Phenylpropionic acid, sodium saltMeSH
beta-PhenylpropionateMeSH
Dihydrocinnamic acidMeSH
Hydrocinnamic acidMeSH
Molecular FormulaC9H9O2
Average Mass149.17
Monoisotopic Mass149.06080311
IUPAC Name3-phenylpropanoate
Traditional Nameβ-phenylpropionate
CAS Registry NumberNot Available
SMILES
[O-]C(=O)CCC1=CC=CC=C1
InChI Identifier
InChI=1S/C9H10O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,10,11)/p-1
InChI KeyXMIIGOLPHOKFCH-UHFFFAOYSA-M