Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:05:28 UTC
Update Date2025-10-07 16:08:27 UTC
Metabolite IDMMDBc0054299
Metabolite Identification
Common Name7-demethylsiderin
Description7-demethylsiderin is a polyketide-derived metabolite that belongs to the class of coumarins. Its chemical structure features a coumarin core, which is significant in various biosynthetic pathways. In particular, 7-demethylsiderin is involved in the dimerization process catalyzed by specific enzymes in fungi, such as Aspergillus niger, leading to the production of kotanin, a compound of interest in secondary metabolism (PMID:22945023 ). Additionally, recombinant cells have been shown to regio- and stereoselectively couple 7-demethylsiderin to form P-orlandin, another dimeric compound (PMID:26389790 ). This coupling reaction highlights the compound's role in the biosynthesis of complex secondary metabolites. Furthermore, in Saccharomyces cerevisiae, the enzyme activity also facilitates the regio- and stereoselective coupling of 7-demethylsiderin to M-desertorin A, indicating its versatility in different biological systems (PMID:26389790 ). Overall, 7-demethylsiderin serves as a crucial intermediate in the synthesis of various bioactive compounds through enzymatic transformations.
Structure
SynonymsNot Available
Molecular FormulaC11H10O4
Average Mass206.197
Monoisotopic Mass206.057908802
IUPAC Name7-hydroxy-4-methoxy-5-methyl-2H-chromen-2-one
Traditional Name7-hydroxy-4-methoxy-5-methylchromen-2-one
CAS Registry NumberNot Available
SMILES
COC1=CC(=O)OC2=CC(O)=CC(C)=C12
InChI Identifier
InChI=1S/C11H10O4/c1-6-3-7(12)4-9-11(6)8(14-2)5-10(13)15-9/h3-5,12H,1-2H3
InChI KeyUMLNUFLSRYJZFA-UHFFFAOYSA-N