Xenobiotic
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:11:58 UTC
Update Date2025-10-07 16:08:30 UTC
Metabolite IDMMDBc0054429
Metabolite Identification
Common NameD-galactono-1,4-lactone
DescriptionD-galactono-1,4-lactone is a lactone and a metabolite involved in various glycosylation reactions. Its chemical structure features a cyclic ester formed from D-galactonic acid, which plays a significant role in carbohydrate chemistry. D-galactono-1,4-lactone serves as a substrate for the synthesis of glycosyl derivatives, as demonstrated in studies where it was utilized alongside other acceptors for glycosylation reactions (PMID:22050997 ). Furthermore, it has been employed in the preparation of other derivatives, such as 2,3,4,6-tetra-O-methyl-D-galactonic acid (PMID:17097075 ). Notably, D-galactono-1,4-lactone is implicated in enzymatic pathways, where it acts as an inhibitor for beta-D-galactofuranosidase produced by Penicillium fellutanum, affecting the synthesis of galactofuranose in cell walls (PMID:12007471 ). Additionally, it has been involved in photochemical reactions, including electron transfer and alpha-deoxygenation processes (PMID:12433476 ). Overall, D-galactono-1,4-lactone is a significant compound in carbohydrate chemistry with various applications in synthetic and enzymatic pathways.
Structure
SynonymsNot Available
Molecular FormulaC6H10O6
Average Mass178.14
Monoisotopic Mass178.047738052
IUPAC NameNot Available
Traditional NameNot Available
CAS Registry NumberNot Available
SMILESNot Available
InChI Identifier
InChI=1S/C6H10O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2-5,7-10H,1H2/t2-,3-,4-,5+/m1/s1
InChI KeySXZYCXMUPBBULW-AIHAYLRMSA-N