Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:12:31 UTC
Update Date2025-10-07 16:04:11 UTC
Metabolite IDMMDBc0054443
Metabolite Identification
Common NameD-xylonate
DescriptionD-xylonate is a dicarboxylic acid and a key metabolite in various biochemical pathways. Its chemical structure features a five-carbon backbone with two carboxyl groups, making it a member of the dicarboxylic acid class. D-xylonate plays a significant role in microbial metabolism, particularly in the Weimberg pathway, where it is involved in the conversion of d-xylose to valuable products. However, the low catalytic activity of d-xylonate dehydratase, crucial for the production of d-1,2,4-butanetriol from d-xylose, leads to the accumulation of d-xylonic acid, presenting a bottleneck in this metabolic route (PMID:40747351 ). Efforts to enhance the activity of d-xylonate dehydratase through enzyme engineering and modification of the iron-sulfur cluster synthesis system have been explored (PMID:40747351 ). Additionally, d-xylonate accumulation in microbial cultures has been linked to inefficiencies in hydrolysis and uptake processes, prompting research into overexpressing transporter genes to improve its utilization (PMID:39021639 ). Overall, d-xylonate is integral to various metabolic pathways, influencing both microbial growth and the production of biochemicals.
Structure
Synonyms
ValueSource
D-Xylonic acidGenerator
Molecular FormulaC5H9O6
Average Mass165.122
Monoisotopic Mass165.04046159
IUPAC Name(2R,3S,4R)-2,3,4,5-tetrahydroxypentanoate
Traditional NameD-xylonate
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(CO)[C@]([H])(O)[C@@]([H])(O)C([O-])=O
InChI Identifier
InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3+,4-/m1/s1
InChI KeyQXKAIJAYHKCRRA-FLRLBIABSA-M