Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:17:49 UTC
Update Date2025-10-07 16:08:34 UTC
Metabolite IDMMDBc0054561
Metabolite Identification
Common NameMg-protoporphyrin IX
DescriptionMg-protoporphyrin IX is a tetrapyrrole compound belonging to the class of porphyrins. Its chemical structure consists of a porphyrin ring coordinated with a magnesium ion, which is critical for its role in various biochemical pathways, particularly in chlorophyll biosynthesis. Mg-protoporphyrin IX serves as an intermediate in the synthesis of chlorophyll, transitioning from protoporphyrin IX to protochlorophyllide, a step that can be hindered in certain conditions, leading to chlorophyll-deficient phenotypes (PMID:38838570 ). The regulation of Mg-protoporphyrin IX, along with other precursors like 5-aminolevulinic acid and porphobilinogen, is influenced by various genetic factors, as seen in studies involving CcGLK transcription factors (PMID:38611466 ). Furthermore, environmental factors such as herbicide application can significantly affect its levels, as demonstrated by the reduction of chlorophyll synthesis precursors, including Mg-protoporphyrin IX, in treated foxtail millet (PMID:40284098 ). The balance of Mg-protoporphyrin IX and its precursors is crucial for maintaining chlorophyll production, with implications for plant health and photosynthesis efficiency (PMID:40598761 ).
Structure
Synonyms
ValueSource
MG-Protoporphyrin IXMetaCyc
Magnesium protoporphyrinMetaCyc
MgPMetaCyc
Molecular FormulaC34H30MgN4O4
Average Mass582.944
Monoisotopic Mass582.21284432
IUPAC Namemagnesium(2+) ion 5,9-bis(2-carboxylatoethyl)-14,19-diethenyl-4,10,15,20-tetramethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1³,⁶.1⁸,¹¹.1¹³,¹⁶]tetracosa-1,3(24),4,6,8(23),9,11,13,15,17,19-undecaene-21,22-diide
Traditional Namemagnesium(2+) ion 5,9-bis(2-carboxylatoethyl)-14,19-diethenyl-4,10,15,20-tetramethyl-21,22,23,24-tetraazapentacyclo[16.2.1.1³,⁶.1⁸,¹¹.1¹³,¹⁶]tetracosa-1,3(24),4,6,8(23),9,11,13,15,17,19-undecaene-21,22-diide
CAS Registry NumberNot Available
SMILES
[Mg++].CC1=C(CCC([O-])=O)C2=N\C\1=C/C1=C(C=C)C(C)=C([N-]1)\C=C1/[N-]\C(=C/C3=N/C(=C\2)/C(CCC([O-])=O)=C3C)C(C)=C1C=C
InChI Identifier
InChI=1S/C34H34N4O4.Mg/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25;/h7-8,13-16H,1-2,9-12H2,3-6H3,(H4,35,36,37,38,39,40,41,42);/q;+2/p-4/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16-;
InChI KeyREJJDEGSUOCEEW-RGGAHWMASA-J