Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:21:57 UTC
Update Date2025-10-07 16:08:36 UTC
Metabolite IDMMDBc0054638
Metabolite Identification
Common Namephthalate
DescriptionPhthalate is a class of chemicals known as phthalate esters, which are commonly used as plasticizers to enhance the flexibility and durability of plastics. Chemically, phthalates are esters of phthalic acid and are characterized by a benzene ring bonded to two carboxylate groups, which can be further esterified with various alcohols. In biological systems, phthalates are metabolized into various metabolites that can be detected in urine, reflecting exposure levels in humans and other organisms (PMID:41038373 ). These metabolites can interact with endocrine pathways, potentially disrupting hormonal functions and leading to adverse health effects (PMID:41029561 ). Detection methods such as liquid chromatography with tandem mass spectrometry have been employed to analyze urinary phthalate metabolites, indicating widespread exposure in populations (PMID:41038373 ). Additionally, innovative sensing technologies, like electrochemical aptasensors, have been developed for the sensitive detection of specific phthalates, such as dibutyl phthalate, showcasing their environmental and health significance (PMID:41043225 ). Overall, phthalates are important chemical compounds in both industrial applications and biological monitoring.
Structure
Synonyms
ValueSource
1,2-BenzenedicarboxylateChEBI
PhthalateChEBI
1,2-Benzenedicarboxylic acidGenerator
Phthalic acidGenerator
Phthalic acid(2-)Generator
Phthalic acid, monopotassium saltMeSH
Disodium phthalateMeSH
Phthalic acid, monosodium saltMeSH
Phthalic acid, monocalcium saltMeSH
Phthalic acid, monoruthenium saltMeSH
Phthalic acid, potassium saltMeSH
Phthalic acid, potassium, sodium saltMeSH
Phthalic acid, copper saltMeSH
Phthalic acid, sodium saltMeSH
Phthalic acid, monoiron (2+) saltMeSH
Phthalic acid, dipotassium saltMeSH
Potassium hydrogen phthalateMeSH
Phthalic acid, disodium saltMeSH
Phthalic acid, monobarium saltMeSH
Phthalic acid, monolead (2+) saltMeSH
Molecular FormulaC8H4O4
Average Mass164.117
Monoisotopic Mass164.012055769
IUPAC Namebenzene-1,2-dicarboxylate
Traditional Namephthalate
CAS Registry NumberNot Available
SMILES
[O-]C(=O)C1=CC=CC=C1C([O-])=O
InChI Identifier
InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12)/p-2
InChI KeyXNGIFLGASWRNHJ-UHFFFAOYSA-L