Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:39:24 UTC
Update Date2025-10-07 16:08:50 UTC
Metabolite IDMMDBc0054992
Metabolite Identification
Common Name(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
Description(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate is a nucleotide derivative belonging to the class of guanosine triphosphates. This compound features a unique cyclization at the 3' and 8 positions of the guanine base, resulting in a bicyclic structure that distinguishes it from standard guanosine triphosphate (GTP). Structural characterization through chemical derivatization, mass spectrometry, and NMR spectroscopy has confirmed its identity as (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate (3',8-cH2GTP) (PMID:23627491 ). In biological systems, this metabolite may participate in various signaling pathways, potentially influencing processes such as RNA synthesis and cellular energy transfer, similar to other guanosine triphosphates. Its unique structure could also suggest specific roles in modulating enzyme activities or interacting with nucleic acids, although the precise biological implications remain to be fully elucidated. Overall, (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate represents a fascinating subject for further investigation in the context of nucleotide metabolism and cellular signaling.
Structure
Synonyms
ValueSource
(8S)-3',8-Cyclo-7,8-dihydroguanosine 5'-triphosphateChEBI
(8S)-3',8-Cyclo-7,8-dihydroguanosine 5'-triphosphoric acidGenerator
(8S)-3',8-Cyclo-7,8-dihydroguanosine 5'-triphosphoric acid(4-)Generator
Molecular FormulaC10H12N5O14P3
Average Mass519.15
Monoisotopic Mass518.9615554
IUPAC Name(1R,10S,11R,12R,14R)-11,14-dihydroxy-12-({[hydroxy(phosphonooxy)phosphoryl phosphono]oxy}methyl)-5-imino-13-oxa-2,4,6,9-tetraazatetracyclo[9.2.1.0^{2,10}.0^{3,8}]tetradeca-3(8),6-dien-7-olate
Traditional Name(1R,10S,11R,12R,14R)-11,14-dihydroxy-12-({[hydroxy(phosphonooxy)phosphoryl phosphono]oxy}methyl)-5-imino-13-oxa-2,4,6,9-tetraazatetracyclo[9.2.1.0^{2,10}.0^{3,8}]tetradeca-3(8),6-dien-7-olate
CAS Registry NumberNot Available
SMILES
[H][C@]1(O)[C@@]2([H])O[C@]([H])(COP([O-])(=O)OP(O)(=O)OP([O-])([O-])=O)[C@@]1(O)[C@@]1([H])NC3=C(NC(=N)N=C3[O-])N21
InChI Identifier
InChI=1S/C10H16N5O14P3/c11-9-13-5-3(6(17)14-9)12-8-10(18)2(27-7(4(10)16)15(5)8)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2,4,7-8,12,16,18H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,17)/p-4/t2-,4+,7-,8+,10+/m1/s1
InChI KeyHRBCPXBJAWPPIC-FLISOKMQSA-J