Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:40:27 UTC
Update Date2025-10-07 16:08:52 UTC
Metabolite IDMMDBc0055035
Metabolite Identification
Common Name(R)-3-phenyllactic acid
Description(R)-3-phenyllactic acid is a chiral organic acid belonging to the class of alpha-hydroxy acids. Its chemical structure features a phenyl group attached to the third carbon of lactic acid, resulting in a unique configuration that influences its biochemical interactions. This compound is involved in various metabolic pathways, particularly in the context of microbial metabolism and potential roles in the human gut microbiome. Notably, (R)-3-phenyllactic acid has been observed to remain stable and unoxidized over extended periods, specifically not undergoing oxidation over a duration of 9 hours (PMID:20014430 ). This stability may contribute to its function in metabolic processes and its interactions with other metabolites. Additionally, its presence in certain fermentation processes highlights its relevance in food chemistry and potential applications in bioprocessing. Overall, (R)-3-phenyllactic acid exemplifies the intricate relationship between chemical structure and biological activity, warranting further investigation into its roles in both health and disease contexts.
Structure
Synonyms
ValueSource
(2R)-2-Hydroxy-3-phenylpropanoic acidGenerator
Molecular FormulaC9H9O3
Average Mass165.169
Monoisotopic Mass165.05571773
IUPAC Name(2R)-2-hydroxy-3-phenylpropanoate
Traditional Name(R)-β-phenyllactate
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(CC1=CC=CC=C1)C([O-])=O
InChI Identifier
InChI=1S/C9H10O3/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8,10H,6H2,(H,11,12)/p-1/t8-/m1/s1
InChI KeyVOXXWSYKYCBWHO-MRVPVSSYSA-M