Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:41:13 UTC
Update Date2025-10-07 16:08:54 UTC
Metabolite IDMMDBc0055068
Metabolite Identification
Common Name(S)-benzoin
Description(S)-benzoin is a chiral compound belonging to the class of alcohols and ketones, specifically classified as a secondary alcohol and a ketone. Its chemical structure features a hydroxyl group (-OH) attached to a benzoin backbone, which consists of two aromatic rings connected by a carbonyl group and a secondary alcohol. (S)-benzoin is synthesized through various methods, including benzyl desymmetrization and rac-benzoin deracemization, under mild conditions such as phosphate buffer (pH 7.0, 7.2) at 30 °C (PMID:33809372 ). Additionally, the enantioselective reduction of benzil to (S)-benzoin has been optimized through the characterization of a new protein, highlighting its relevance in synthetic organic chemistry (PMID:26377422 ). The enantioselectivity observed in the reactions is attributed to specific hydrogen bonding and π-π interactions, which play a crucial role in stabilizing the transition states of the reactants (PMID:21942429 ). (S)-benzoin is involved in various biochemical pathways, including those related to the synthesis of pharmaceuticals and other biologically active compounds, reflecting its importance in both chemistry and biology.
Structure
Synonyms
ValueSource
(S)-(+)-BenzoinChEBI
Molecular FormulaC14H12O2
Average Mass212.248
Monoisotopic Mass212.083729626
IUPAC Name(2S)-2-hydroxy-1,2-diphenylethan-1-one
Traditional Name(S)-benzoin
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(C(=O)C1=CC=CC=C1)C1=CC=CC=C1
InChI Identifier
InChI=1S/C14H12O2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13,15H/t13-/m0/s1
InChI KeyISAOCJYIOMOJEB-ZDUSSCGKSA-N