Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:45:43 UTC
Update Date2025-10-07 16:08:59 UTC
Metabolite IDMMDBc0055185
Metabolite Identification
Common Name17-hydroxylupanine
Description17-hydroxylupanine is a quinolizidine alkaloid, a chemical class known for its diverse biological activities and structural complexity. Its chemical structure features a fused bicyclic system, which is characteristic of alkaloids, contributing to its unique properties. The compound is involved in various metabolic pathways, particularly those related to the biosynthesis and degradation of alkaloids. Studies have examined the mass spectra of bis-quinolizidine alkaloids, including 17-hydroxylupanine, revealing insights into their fragmentation patterns and molecular cation behavior (PMID:24362987 ). Additionally, pharmacological investigations have explored the effects of 17-hydroxylupanine alongside related compounds, such as 17-oxolupanine and lupanine aminooxide, highlighting its potential interactions and mechanisms of action (PMID:5945524 ). These studies contribute to a deeper understanding of the chemical behavior and biological implications of 17-hydroxylupanine within the broader context of quinolizidine alkaloids.
Structure
Synonyms
ValueSource
17-HydroxylupanineChEBI
17-HydroxylupaniniumChEBI
Molecular FormulaC15H25N2O2
Average Mass265.376
Monoisotopic Mass265.191054473
IUPAC Name(1S,2S,9R,10R)-8-hydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.0^{2,7}.0^{10,15}]heptadecan-7-ium
Traditional Name(1S,2S,9R,10R)-8-hydroxy-14-oxo-7,15-diazatetracyclo[7.7.1.0^{2,7}.0^{10,15}]heptadecan-7-ium
CAS Registry NumberNot Available
SMILES
[H]C1(O)[NH+]2CCCC[C@@]2([H])[C@]2([H])CN3C(=O)CCC[C@]3([H])[C@@]1([H])C2
InChI Identifier
InChI=1S/C15H24N2O2/c18-14-6-3-5-13-11-8-10(9-17(13)14)12-4-1-2-7-16(12)15(11)19/h10-13,15,19H,1-9H2/p+1/t10-,11+,12-,13+,15?/m0/s1
InChI KeyLCORZQTZVFOPGT-IZADBBIGSA-O