Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:46:59 UTC
Update Date2025-10-07 16:09:01 UTC
Metabolite IDMMDBc0055236
Metabolite Identification
Common Name2-hydroxy-5-carboxymethylmuconic acid semialdehyde
Description2-hydroxy-5-carboxymethylmuconic acid semialdehyde is a metabolite classified within the broader category of organic acids, specifically related to muconic acid derivatives. Its chemical structure features a hydroxyl group and a carboxymethyl group attached to a muconic acid backbone, contributing to its reactivity and potential biological roles. This compound is involved in metabolic pathways that include the degradation of aromatic compounds, where it serves as an intermediate in the catabolism of phenolic substances. The production of 2-hydroxy-5-carboxymethylmuconic acid semialdehyde has been demonstrated to be due to the production of a muconic acid (PMID:16347803 ). This indicates its relevance in microbial metabolism, particularly in the context of bioremediation processes where microorganisms utilize aromatic compounds as carbon sources. Understanding the chemistry and pathways involving this metabolite can provide insights into its role in environmental and industrial applications, as well as its potential interactions within biological systems.
Structure
Synonyms
ValueSource
2-Hydroxy-5-carboxymethylmuconate semialdehydeChEBI
5-Formyl-2-hydroxyhepta-2,4-dienedioate dianionChEBI
5-Formyl-2-hydroxyhepta-2,4-dienedioate(2-)ChEBI
2-Hydroxy-5-carboxymethylmuconic acid semialdehydeGenerator
5-Formyl-2-hydroxyhepta-2,4-dienedioic acid dianionGenerator
5-Formyl-2-hydroxyhepta-2,4-dienedioic acid(2-)Generator
5-Formyl-2-hydroxyhepta-2,4-dienedioic acidGenerator
Molecular FormulaC8H6O6
Average Mass198.131
Monoisotopic Mass198.017535073
IUPAC Name(3Z,5Z)-6-carboxy-3-formyl-6-oxidohexa-3,5-dienoate
Traditional Name(3Z,5Z)-6-carboxy-3-formyl-6-oxidohexa-3,5-dienoate
CAS Registry NumberNot Available
SMILES
[H]\C(\C(\[H])=C(\CC([O-])=O)C=O)=C(\[O-])C(O)=O
InChI Identifier
InChI=1S/C8H8O6/c9-4-5(3-7(11)12)1-2-6(10)8(13)14/h1-2,4,10H,3H2,(H,11,12)(H,13,14)/p-2/b5-1-,6-2-
InChI KeyNLXIEJRQAIHYPN-IOBHVTPZSA-L