Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:48:39 UTC
Update Date2025-10-07 16:09:03 UTC
Metabolite IDMMDBc0055299
Metabolite Identification
Common Name2,4,5-trihydroxyphenylacetic acid
Description2,4,5-trihydroxyphenylacetic acid is a phenolic compound classified as a metabolite. Its chemical structure features a phenyl ring with three hydroxyl groups located at the 2, 4, and 5 positions, along with an acetic acid side chain. This compound is involved in various biochemical pathways, particularly in the context of redox reactions where it can form a semiquinonic radical, which has been unambiguously attributed to its structure (PMID:27414279 ). The presence of multiple hydroxyl groups enhances its reactivity and potential interactions with biological molecules, suggesting a role in oxidative stress and signaling pathways. As a metabolite, it may also participate in the degradation of phenolic compounds, contributing to the overall metabolic processes in organisms. The understanding of its chemical properties and biological interactions is crucial for elucidating its role in metabolic pathways and potential implications in health and disease.
Structure
Synonyms
ValueSource
2,4,5-Trihydroxyphenylacetic acidGenerator
Molecular FormulaC8H7O5
Average Mass183.14
Monoisotopic Mass183.029896905
IUPAC Name2-(carboxymethyl)-4,5-dihydroxybenzen-1-olate
Traditional Name2-(carboxymethyl)-4,5-dihydroxybenzenolate
CAS Registry NumberNot Available
SMILES
OC(=O)CC1=CC(O)=C(O)C=C1[O-]
InChI Identifier
InChI=1S/C8H8O5/c9-5-3-7(11)6(10)1-4(5)2-8(12)13/h1,3,9-11H,2H2,(H,12,13)/p-1
InChI KeyFKWSAXDBQYTQDO-UHFFFAOYSA-M