Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:49:41 UTC
Update Date2025-10-07 16:04:20 UTC
Metabolite IDMMDBc0055344
Metabolite Identification
Common Name3-amino-4-hydroxybenzoic acid
Description3-amino-4-hydroxybenzoic acid is a γ-amino acid and an aromatic compound that serves as a significant metabolite in various biochemical pathways. Its chemical structure features an amino group and a hydroxyl group attached to a benzoic acid framework, which contributes to its reactivity and functionality in biological systems. This compound has been identified as a characteristic metabolite for diagnosing mild cognitive impairment due to Alzheimer's disease (PMID:38069159 ). Additionally, it plays a role in the synthesis of coenzyme Q (UQ), which is essential for cellular growth, as demonstrated by studies using inhibitors like 3-amino-4-hydroxybenzoic acid (PMID:34543102 ). Furthermore, it has been utilized in the production of high-performance industrial plastics and thermostable bioplastics, highlighting its versatility in material science (PMID:35831135 , PMID:34949178 ). The compound also serves as a functional monomer in the electropolymerization process for creating molecularly imprinted polymers (MIPs) (PMID:33470260 ). Overall, 3-amino-4-hydroxybenzoic acid is a compound of interest in both chemistry and biology, with applications ranging from diagnostics to materials development.
Structure
Synonyms
ValueSource
3-Amino-4-hydroxybenzoate anionChEBI
3-Amino-4-hydroxybenzoic acid anionGenerator
3-Amino-4-hydroxybenzoic acidGenerator
Molecular FormulaC7H6NO3
Average Mass152.13
Monoisotopic Mass152.035316637
IUPAC Name2-amino-4-carboxybenzen-1-olate
Traditional Name2-amino-4-carboxybenzenolate
CAS Registry NumberNot Available
SMILES
NC1=C([O-])C=CC(=C1)C(O)=O
InChI Identifier
InChI=1S/C7H7NO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,8H2,(H,10,11)/p-1
InChI KeyMRBKRZAPGUCWOS-UHFFFAOYSA-M