Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 19:58:29 UTC
Update Date2025-10-07 16:09:11 UTC
Metabolite IDMMDBc0055542
Metabolite Identification
Common Name4,4'-diaponeurosporenoic acid
Description4,4'-diaponeurosporenoic acid is a carotenoid derivative belonging to the chemical class of terpenoids. Its chemical structure features a complex arrangement of carbon atoms, characteristic of carotenoids, which are known for their role in light absorption and photoprotection in various organisms. This compound is synthesized through a series of enzymatic reactions involving the conversion of precursors such as 4,4'-diapophytoene and 4,4'-diaponeurosporene, facilitated by enzymes like CrtP2 and AldH, which catalyze the oxidation processes necessary for its formation (PMID:22535955 , PMID:33322786 ). In microbial systems, particularly in Staphylococcus xylosus, naringenin has been shown to significantly influence the carotenoid profile, leading to an increased relative proportion of 4,4'-diaponeurosporenoic acid (PMID:36746312 ). Additionally, it is involved in the biosynthetic pathway leading to staphyloxanthin, a major pigment, indicating its role in the metabolic processes that contribute to the coloration and potential protective functions of certain bacteria (PMID:7275937 ). Overall, 4,4'-diaponeurosporenoic acid exemplifies the intricate biochemical pathways that generate diverse carotenoid compounds.
Structure
Synonyms
ValueSource
4,4'-Diaponeurosporenoic acidGenerator
Molecular FormulaC30H39O2
Average Mass431.641
Monoisotopic Mass431.295554076
IUPAC Name(2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoate
Traditional Name(2E,4E,6E,8E,10E,12E,14E,16E,18E)-2,6,10,15,19,23-hexamethyltetracosa-2,4,6,8,10,12,14,16,18,22-decaenoate
CAS Registry NumberNot Available
SMILES
[H]/C(=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)C([O-])=O)/C(/[H])=C(\C)/C(/[H])=C(\[H])/C(/[H])=C(\C)CCC=C(C)C
InChI Identifier
InChI=1S/C30H40O2/c1-24(2)14-10-17-27(5)20-11-18-25(3)15-8-9-16-26(4)19-12-21-28(6)22-13-23-29(7)30(31)32/h8-9,11-16,18-23H,10,17H2,1-7H3,(H,31,32)/p-1/b9-8+,18-11+,19-12+,22-13+,25-15+,26-16+,27-20+,28-21+,29-23+
InChI KeyNXJSQJIGCCIMAE-ORIYTCASSA-M