Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:08:46 UTC
Update Date2025-10-07 16:09:25 UTC
Metabolite IDMMDBc0055851
Metabolite Identification
Common NameD-arabinonate
DescriptionD-arabinonate is a dicarboxylic acid and a member of the class of sugar acids. It plays a role in various biochemical pathways, particularly in pentose metabolism, where it is involved in the dehydration processes catalyzed by specific enzymes such as d-arabinonate dehydratases. For instance, the C785_RS13685 gene in Herbaspirillum huttiense IAM 15032 encodes a d-arabinonate dehydratase that is clustered with genes associated with pentose metabolism (PMID:30985034 ). Additionally, structural studies have provided insights into the substrate binding and catalytic mechanisms of enzymes like the novel 2-keto-3-deoxy-D-arabinonate dehydratase, which is crucial in the third step of its metabolic pathway (PMID:18448118 ). D-arabinonate also exhibits substrate promiscuity, as it can be dehydrated by enzymes that also act on other sugar acids like L-fuconate and D-altronate (PMID:17144652 ). Furthermore, biochemical analyses have highlighted its unique heterodimeric structure and specificity compared to other sugar acids (PMID:38017627 ). Overall, D-arabinonate is an important metabolite in the context of sugar acid metabolism and enzymatic reactions.
Structure
Synonyms
ValueSource
D-Arabinonic acidGenerator
Molecular FormulaC5H9O6
Average Mass165.122
Monoisotopic Mass165.04046159
IUPAC Name(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate
Traditional NameD-arabinonate
CAS Registry NumberNot Available
SMILES
[H][C@@](O)(CO)[C@@]([H])(O)[C@]([H])(O)C([O-])=O
InChI Identifier
InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3-,4+/m1/s1
InChI KeyQXKAIJAYHKCRRA-JJYYJPOSSA-M