Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:09:05 UTC
Update Date2025-10-07 16:09:25 UTC
Metabolite IDMMDBc0055862
Metabolite Identification
Common NameD-galacto-hexodialdose
DescriptionD-galacto-hexodialdose is a carbohydrate belonging to the class of hexose sugars, specifically a dialdose. Its chemical structure features a six-carbon backbone with aldehyde groups at both ends, making it a crucial intermediate in various metabolic pathways. This compound plays a role in carbohydrate metabolism, particularly in the oxidation processes involving galactose. For instance, affinity chromatography studies have utilized D-galacto-hexodialdose derivatives to isolate myo-inositol oxygenase from rat kidney, highlighting its interaction with enzymes in metabolic pathways (PMID:6707116 ). Additionally, D-galacto-hexodialdose can be modified through chemical reactions, such as partial acid hydrolysis followed by treatment with galactose oxidase, resulting in an insoluble matrix containing 3-O-substituted D-galacto-hexodialdose (PMID:6707116 ). These processes underscore its significance in biochemical research and its potential applications in understanding carbohydrate metabolism and enzyme interactions.
Structure
SynonymsNot Available
Molecular FormulaC6H10O6
Average Mass178.14
Monoisotopic Mass178.047738042
IUPAC Name(2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexanedial
Traditional NameD-galacto-hexodialdose
CAS Registry NumberNot Available
SMILES
[H][C@](O)(C=O)[C@@]([H])(O)[C@@]([H])(O)[C@]([H])(O)C=O
InChI Identifier
InChI=1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1-6,9-12H/t3-,4+,5+,6-
InChI KeyVYPPEYAOCURAAE-GUCUJZIJSA-N