Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:10:50 UTC
Update Date2025-10-07 16:04:20 UTC
Metabolite IDMMDBc0055923
Metabolite Identification
Common Namedihydrodigitoxin
DescriptionDihydrodigitoxin is a cardiac glycoside belonging to the chemical class of steroid compounds. Its chemical structure features a steroid backbone with specific hydroxyl and sugar moieties that contribute to its biological activity. Dihydrodigitoxin is involved in the inhibition of the (Na+ + K+)-ATPase enzyme, a critical component of cardiac muscle function, which regulates ion transport across cell membranes. This inhibition can lead to increased intracellular calcium concentrations, enhancing cardiac contractility. Studies have demonstrated the binding affinity of dihydrodigitoxin to beef and human cardiac (Na+ + K+)-ATPase, revealing two distinct binding sites and providing insights into its pharmacological properties (PMID:6315020 ). The stereochemical configuration at C-20 of dihydrodigitoxin is identified as R, which may influence its interaction with the enzyme (PMID:3579289 ). Additionally, comparative studies of binding affinities among cardiac glycosides indicate that dihydrodigitoxin has a higher dissociation constant than digitoxin and ouabain, suggesting a relatively lower potency in inhibiting the (Na+ + K+)-ATPase (PMID:6315020 ). Overall, dihydrodigitoxin plays a significant role in cardiac physiology through its interactions with ion transport mechanisms.
Structure
Synonyms
ValueSource
20,22-DihydrodigitoxinChEBI
Molecular FormulaC41H66O13
Average Mass766.966
Monoisotopic Mass766.450342185
IUPAC Name(4R)-4-[(1S,2S,5S,7R,10R,11S,14R,15R)-5-{[(2R,4S,5S,6R)-5-{[(2S,4S,5S,6R)-5-{[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy}-4-hydroxy-6-methyloxan-2-yl]oxy}-4-hydroxy-6-methyloxan-2-yl]oxy}-11-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]oxolan-2-one
Traditional Name(4R)-4-[(1S,2S,5S,7R,10R,11S,14R,15R)-5-{[(2R,4S,5S,6R)-5-{[(2S,4S,5S,6R)-5-{[(2S,4S,5S,6R)-4,5-dihydroxy-6-methyloxan-2-yl]oxy}-4-hydroxy-6-methyloxan-2-yl]oxy}-4-hydroxy-6-methyloxan-2-yl]oxy}-11-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]oxolan-2-one
CAS Registry NumberNot Available
SMILES
[H][C@]1(COC(=O)C1)[C@@]1([H])CC[C@]2(O)[C@]3([H])CC[C@]4([H])C[C@]([H])(CC[C@]4(C)[C@@]3([H])CC[C@]12C)O[C@@]1([H])C[C@]([H])(O)[C@]([H])(O[C@@]2([H])C[C@]([H])(O)[C@]([H])(O[C@@]3([H])C[C@]([H])(O)[C@]([H])(O)[C@@]([H])(C)O3)[C@@]([H])(C)O2)[C@@]([H])(C)O1
InChI Identifier
InChI=1S/C41H66O13/c1-20-36(46)29(42)16-34(49-20)53-38-22(3)51-35(18-31(38)44)54-37-21(2)50-33(17-30(37)43)52-25-8-11-39(4)24(15-25)6-7-28-27(39)9-12-40(5)26(10-13-41(28,40)47)23-14-32(45)48-19-23/h20-31,33-38,42-44,46-47H,6-19H2,1-5H3/t20-,21-,22-,23+,24-,25+,26-,27+,28-,29+,30+,31+,33+,34+,35+,36-,37-,38-,39+,40-,41+/m1/s1
InChI KeyWWCGMGNIMDOEGK-XWQQVMAMSA-N