Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:19:57 UTC
Update Date2025-10-07 16:09:40 UTC
Metabolite IDMMDBc0056223
Metabolite Identification
Common Namenonane-4,6-dione
DescriptionNonane-4,6-dione is a diketone compound classified as a metabolite within the broader category of organic compounds. Its chemical structure features two carbonyl groups located at the 4th and 6th positions of a nonane chain, which influences its reactivity and interactions in biological systems. Nonane-4,6-dione is involved in various metabolic pathways, particularly in the degradation of fatty acids and other lipids. For instance, a specific strain, VM15C, utilizes nonane-4,6-dione as a substrate, cleaving it into butyrate and pentan-2-one through the action of a serine-triad hydrolase enzyme (PMID:15934927 ). This enzymatic process highlights the compound's role in microbial metabolism, showcasing its potential as a carbon source for certain microorganisms. Additionally, the presence of nonane-4,6-dione in metabolic pathways may indicate its involvement in energy production and the synthesis of other biologically relevant molecules, further emphasizing its significance in biochemical processes.
Structure
SynonymsNot Available
Molecular FormulaC9H16O2
Average Mass156.225
Monoisotopic Mass156.115029755
IUPAC Namenonane-4,6-dione
Traditional Name4,6-nonanedione
CAS Registry NumberNot Available
SMILES
CCCC(=O)CC(=O)CCC
InChI Identifier
InChI=1S/C9H16O2/c1-3-5-8(10)7-9(11)6-4-2/h3-7H2,1-2H3
InChI KeyZDYWPVCQPUPOJV-UHFFFAOYSA-N