Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:21:00 UTC
Update Date2025-10-07 16:09:41 UTC
Metabolite IDMMDBc0056260
Metabolite Identification
Common Namepreaustinoid A1
DescriptionPreaustinoid A1 is a meroterpenoid, a chemical class that combines terpenoid and non-terpenoid components, characterized by its complex structure featuring multiple functional groups and stereocenters. Its chemical formula is C26H36O7, and it possesses a unique arrangement that includes a cycloheptadiene moiety and a spiro-lactone structure. Preaustinoid A1 serves as a substrate for two homologous Fe(II)/αKG oxygenases, AusE from Aspergillus nidulans and PrhA from Penicillium brasilianum, which catalyze divergent rearrangement reactions leading to the formation of distinct products such as austinol and paraherquonin (PMID:29317628 ). The reaction mechanisms involving preaustinoid A1 have been elucidated through computational models and QM/MM calculations, revealing the intricate pathways through which these enzymes operate (PMID:31725143 ). Additionally, the absolute configuration of preaustinoid A1 has been determined using resonant scattering techniques (PMID:26396816 ). This metabolite has been isolated from fungal cultures, highlighting its significance in the biosynthetic landscape of meroterpenoids (PMID:14577628 , PMID:19678538 ).
Structure
SynonymsNot Available
Molecular FormulaC26H36O7
Average Mass460.567
Monoisotopic Mass460.246103499
IUPAC Namemethyl (1R,2S,5S,11S,12S,14R,16S)-16-hydroxy-2,6,6,11,14,16-hexamethyl-18-methylidene-8,15,17-trioxo-7-oxatetracyclo[12.3.1.0^{2,12}.0^{5,11}]octadecane-1-carboxylate
Traditional Namemethyl (1R,2S,5S,11S,12S,14R,16S)-16-hydroxy-2,6,6,11,14,16-hexamethyl-18-methylidene-8,15,17-trioxo-7-oxatetracyclo[12.3.1.0^{2,12}.0^{5,11}]octadecane-1-carboxylate
CAS Registry NumberNot Available
SMILES
[H][C@@]12C[C@]3(C)C(=C)[C@@](C(=O)OC)(C(=O)[C@@](C)(O)C3=O)[C@@]1(C)CC[C@@]1([H])[C@@]2(C)CCC(=O)OC1(C)C
InChI Identifier
InChI=1S/C26H36O7/c1-14-23(5)13-16-22(4)11-10-17(27)33-21(2,3)15(22)9-12-24(16,6)26(14,20(30)32-8)19(29)25(7,31)18(23)28/h15-16,31H,1,9-13H2,2-8H3/t15-,16+,22-,23-,24+,25+,26+/m1/s1
InChI KeyXBLDTXYFLHSWHN-RFMSQVAGSA-N