Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:21:03 UTC
Update Date2025-10-07 16:09:42 UTC
Metabolite IDMMDBc0056262
Metabolite Identification
Common Namepreaustinoid A3
DescriptionPreaustinoid A3 is a meroterpenoid, a chemical class that combines terpenoid and non-terpenoid components. Its chemical structure features a spiro-lactone system, which is significant in the context of its biosynthesis. The conversion of protoaustinoid A to preaustinoid A3 represents a critical step in the meroterpenoid biosynthetic pathway, although the exact mechanisms remain unclear (PMID:23865690 ). The hydroxylation of preaustinoid A3 involves a high barrier O-rebound process, primarily due to the considerable distance between the Fe-OH and -CH2 radical (PMID:31725143 ). Additionally, the dioxygenase involved in its synthesis shares a high degree of sequence identity with PrhA and is capable of accepting multiple substrates, producing preaustinoid A3 as a distinct product, thus indicating a divergence in the metabolic pathways within the same species (PMID:27602587 ). These insights into the chemical structure and biosynthetic pathways of preaustinoid A3 enhance our understanding of its role in the broader context of meroterpenoid metabolism.
Structure
SynonymsNot Available
Molecular FormulaC26H32O7
Average Mass456.535
Monoisotopic Mass456.21480337
IUPAC Namemethyl (1'S,2'S,3R,9'R,11'S)-11'-hydroxy-2,2,2',6',9',11'-hexamethyl-13'-methylidene-6,10',12'-trioxo-2,6-dihydrospiro[pyran-3,5'-tricyclo[7.3.1.0^{2,7}]tridecan]-6'-ene-1'-carboxylate
Traditional Namemethyl (1'S,2'S,3R,9'R,11'S)-11'-hydroxy-2,2,2',6',9',11'-hexamethyl-13'-methylidene-6,10',12'-trioxospiro[pyran-3,5'-tricyclo[7.3.1.0^{2,7}]tridecan]-6'-ene-1'-carboxylate
CAS Registry NumberNot Available
SMILES
COC(=O)[C@@]12C(=C)[C@@](C)(CC3=C(C)[C@@]4(CC[C@]13C)C=CC(=O)OC4(C)C)C(=O)[C@](C)(O)C2=O
InChI Identifier
InChI=1S/C26H32O7/c1-14-16-13-22(5)15(2)26(20(30)32-8,19(29)24(7,31)18(22)28)23(16,6)11-12-25(14)10-9-17(27)33-21(25,3)4/h9-10,31H,2,11-13H2,1,3-8H3/t22-,23+,24+,25+,26+/m1/s1
InChI KeyHYHJAMQARBFCBV-RXBPMRIASA-N