Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:21:39 UTC
Update Date2025-10-07 16:09:42 UTC
Metabolite IDMMDBc0056280
Metabolite Identification
Common Namepyrazine-2-carboxylic acid
DescriptionPyrazine-2-carboxylic acid is a heterocyclic compound belonging to the class of carboxylic acids. Its chemical structure features a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms, along with a carboxylic acid functional group (-COOH) at the 2-position. This compound has garnered attention in coordination chemistry, particularly for its ability to form complexes with various metal ions. For instance, studies have demonstrated the synthesis of new complexes involving pyrazine-2-carboxylic acid with metals such as zinc, manganese, cobalt, and nickel, highlighting its potential role as a ligand in metal coordination (PMID:40109048 ). These metal complexes may participate in various biochemical pathways, including catalysis and electron transfer processes, which are essential for metabolic reactions. The interactions of pyrazine-2-carboxylic acid with metal ions could also influence its reactivity and stability in biological systems, although specific biological pathways involving this metabolite remain to be fully elucidated. Overall, pyrazine-2-carboxylic acid serves as an important compound in both synthetic and biological chemistry contexts.
Structure
Synonyms
ValueSource
2-PyrazinecarboxylateChEBI
PyrazinoateChEBI
2-Pyrazinecarboxylic acidGenerator
Pyrazinoic acidGenerator
PYRAZINE-2-carboxylic acidGenerator
Molecular FormulaC5H3N2O2
Average Mass123.092
Monoisotopic Mass123.020000925
IUPAC Namepyrazine-2-carboxylate
Traditional Namepyrazine-2-carboxylate
CAS Registry NumberNot Available
SMILES
[O-]C(=O)C1=CN=CC=N1
InChI Identifier
InChI=1S/C5H4N2O2/c8-5(9)4-3-6-1-2-7-4/h1-3H,(H,8,9)/p-1
InChI KeyNIPZZXUFJPQHNH-UHFFFAOYSA-M