Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-17 20:24:09 UTC
Update Date2025-10-07 16:09:46 UTC
Metabolite IDMMDBc0056379
Metabolite Identification
Common Nameversicolorin B
DescriptionVersicolorin B is a secondary metabolite belonging to the chemical class of anthraquinones. It plays a significant role in the biosynthetic pathways of various fungal metabolites, particularly in the synthesis of aflatoxins, where versicolorin B synthase acts as a key catalytic enzyme for heterochrome B synthesis during aflatoxin production (PMID:36566904 ). Additionally, versicolorin B has been identified as a promising candidate in molecular docking studies, demonstrating superior binding affinities to the SD protein, outperforming conventional fungicides (PMID:39681474 ). The stability of the docked complexes involving versicolorin B was confirmed through molecular dynamics simulations, indicating favorable binding free energies (PMID:39681474 ). Furthermore, it has been isolated from various fungal cultures, including Aspergillus species, highlighting its prevalence in the fungal metabolome (PMID:34722462 ; PMID:36970635 ). Versicolorin B has also shown inhibitory effects on the mycelial growth and conidial germination of certain fungi, suggesting its potential utility in biocontrol applications (PMID:36970635 ). Overall, versicolorin B is a crucial compound in fungal secondary metabolism with implications for both chemical and biological research.
Structure
Synonyms
ValueSource
Versicolorin bChEBI
Molecular FormulaC18H11O7
Average Mass339.28
Monoisotopic Mass339.051026274
IUPAC Name(4S,8R)-2,18-dihydroxy-13,20-dioxo-7,9-dioxapentacyclo[10.8.0.0^{3,10}.0^{4,8}.0^{14,19}]icosa-1,3(10),11,14(19),15,17-hexaen-16-olate
Traditional Name(4S,8R)-2,18-dihydroxy-13,20-dioxo-7,9-dioxapentacyclo[10.8.0.0^{3,10}.0^{4,8}.0^{14,19}]icosa-1,3(10),11,14(19),15,17-hexaen-16-olate
CAS Registry NumberNot Available
SMILES
[H][C@]12OCC[C@@]1([H])C1=C(O2)C=C2C(=O)C3=C(C(O)=CC([O-])=C3)C(=O)C2=C1O
InChI Identifier
InChI=1S/C18H12O7/c19-6-3-8-12(10(20)4-6)16(22)14-9(15(8)21)5-11-13(17(14)23)7-1-2-24-18(7)25-11/h3-5,7,18-20,23H,1-2H2/p-1/t7-,18+/m0/s1
InChI KeyBABJNKGTTYCTOO-ULCDLSAGSA-M