Microbial
Record Information
Version1.0
StatusDetected and Quantified
Creation Date2022-10-25 16:47:17 UTC
Update Date2025-10-07 16:09:50 UTC
Metabolite IDMMDBc0057127
Metabolite Identification
Common NameR-Dihydrodaidzein
DescriptionR-Dihydrodaidzein is a flavonoid, specifically a metabolite derived from the isoflavonoid daidzein. Its chemical structure features a 3-phenylchromen-4-one backbone, characterized by the presence of hydroxyl groups that contribute to its biological activity. The compound is produced through the reduction of daidzein, and it is known to be synthesized in a highly stereo-selective manner alongside R-dihydrogenistein from daidzein and genistein (PMID:29699942 ). In terms of biochemical pathways, R-dihydrodaidzein participates in various metabolic processes, including those related to estrogenic activity, as it can interact with estrogen receptors. This interaction may influence signaling pathways involved in cell proliferation and differentiation. Additionally, R-dihydrodaidzein may undergo further metabolic transformations in the body, contributing to the overall pharmacokinetics of isoflavones and their potential effects on health.
Structure
SynonymsNot Available
Molecular FormulaC15H12O4
Average Mass256.257
Monoisotopic Mass256.073558866
IUPAC Name(3R)-7-hydroxy-3-(4-hydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-4-one
Traditional Name(3R)-7-hydroxy-3-(4-hydroxyphenyl)-2,3-dihydro-1-benzopyran-4-one
CAS Registry NumberNot Available
SMILES
OC1=CC=C(C=C1)[C@@H]1COC2=C(C=CC(O)=C2)C1=O
InChI Identifier
InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-7,13,16-17H,8H2/t13-/m0/s1
InChI KeyJHYXBPPMXZIHKG-ZDUSSCGKSA-N