Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-11-09 19:28:41 UTC
Update Date2025-10-07 16:09:55 UTC
Metabolite IDMMDBc0057187
Metabolite Identification
Common Name2'-O-Methylguanosine 5'-monophosphate
Description2'-O-Methylguanosine 5'-monophosphate is a ribonucleoside metabolite belonging to the class of modified nucleotides. Its chemical structure features a guanosine base attached to a ribose sugar that has a methyl group at the 2' position, resulting in increased stability and potential roles in RNA processing and function. This modification is often found in various RNA species, including tRNA and rRNA, where it plays a critical role in maintaining structural integrity and enhancing the fidelity of protein synthesis. The presence of 2'-O-methylguanosine 5'-monophosphate in RNA can influence interactions with ribosomal proteins and other RNA-binding factors, thereby affecting translation efficiency and accuracy. Additionally, antibodies have been developed that specifically recognize this ribose methylated nucleotide, highlighting its significance in biochemical assays and research (PMID:6269628 ). The ability to target 2'-O-methylguanosine 5'-monophosphate with specific antibodies underscores its importance in understanding the molecular mechanisms of RNA modifications and their implications in cellular processes (PMID:6269628 ).
Structure
Synonyms
ValueSource
2-O-mGMPChEBI
2'-O-Methylguanosine 5'-monophosphoric acidGenerator
Molecular FormulaC11H16N5O8P
Average Mass377.2472
Monoisotopic Mass377.073649025
IUPAC Name{[(2R,3R,4R,5R)-3-hydroxy-5-(6-hydroxy-2-imino-3,9-dihydro-2H-purin-9-yl)-4-methoxyoxolan-2-yl]methoxy}phosphonic acid
Traditional Name[(2R,3R,4R,5R)-3-hydroxy-5-(6-hydroxy-2-imino-3H-purin-9-yl)-4-methoxyoxolan-2-yl]methoxyphosphonic acid
CAS Registry NumberNot Available
SMILES
[H][C@]1(COP(O)(O)=O)O[C@@]([H])(N2C=NC3=C2NC(=N)N=C3O)[C@]([H])(OC)[C@]1([H])O
InChI Identifier
InChI=1S/C11H16N5O8P/c1-22-7-6(17)4(2-23-25(19,20)21)24-10(7)16-3-13-5-8(16)14-11(12)15-9(5)18/h3-4,6-7,10,17H,2H2,1H3,(H2,19,20,21)(H3,12,14,15,18)/t4-,6-,7-,10-/m1/s1
InChI KeyYPMKZCOIEXUDSS-KQYNXXCUSA-N