Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 01:37:08 UTC
Update Date2025-10-07 16:05:32 UTC
Metabolite IDMMDBc0008949
Metabolite Identification
Common NameMK-8
DescriptionMK-8 is a menaquinone, a type of respiratory quinone that plays a crucial role in electron transport and energy metabolism in various bacteria. It has been identified as a major metabolite in several strains, including strain YIM 134068T, where it serves as the predominant respiratory quinone alongside significant cellular fatty acids such as summed feature 3 and C16:0N alcohol (PMID:40856804 ). Additionally, MK-8(H4) has been noted as the primary menaquinone in other studies, indicating its importance in cellular respiration and metabolic processes (PMID:40522818 ). The presence of MK-8 is often associated with specific chemotaxonomic characteristics, as seen in strain NT6NT, where it coexists with other menaquinones like MK-9 and is accompanied by various fatty acids (PMID:40621810 ). Furthermore, MK-8 has been characterized alongside other MK analogues, emphasizing its relevance in the broader context of quinone chemistry (PMID:40483419 ). The identification of MK-8 as a predominant ubiquinone in certain strains further highlights its significance in microbial energy metabolism (PMID:40512224 ). Overall, MK-8 is a vital component in the biochemical landscape of bacteria, contributing to their respiratory capabilities.
Structure
SynonymsNot Available
Molecular FormulaC51H72O2
Average Mass717.135
Monoisotopic Mass716.553231558
IUPAC Name2-methyl-3-(3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaen-1-yl)-1,4-dihydronaphthalene-1,4-dione
Traditional Name2-methyl-3-(3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,14,18,22,26,30-octaen-1-yl)naphthalene-1,4-dione
CAS Registry NumberNot Available
SMILES
CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1=C(C)C(=O)C2=CC=CC=C2C1=O
InChI Identifier
InChI=1S/C51H72O2/c1-38(2)20-13-21-39(3)22-14-23-40(4)24-15-25-41(5)26-16-27-42(6)28-17-29-43(7)30-18-31-44(8)32-19-33-45(9)36-37-47-46(10)50(52)48-34-11-12-35-49(48)51(47)53/h11-12,20,22,24,26,28,30,32,34-36H,13-19,21,23,25,27,29,31,33,37H2,1-10H3
InChI KeyLXKDFTDVRVLXFY-UHFFFAOYSA-N