Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2021-05-15 03:34:31 UTC
Update Date2025-10-07 16:05:55 UTC
Metabolite IDMMDBc0011865
Metabolite Identification
Common NameNonaflavuxanthin
DescriptionNonaflavuxanthin is a carotenoid, a class of pigments widely found in nature that play essential roles in photosynthesis and photoprotection. This metabolite is synthesized from the precursor farnesyl pyrophosphate (FPP) through a series of enzymatic reactions involving C(40) lycopene and C(50) flavuxanthin, ultimately leading to the production of sarcinaxanthin (PMID:20802040 ). The structure of nonaflavuxanthin is characterized by its unique arrangement of hydroxy and methyl groups, specifically identified as 2-(4-hydroxy-3-methyl-2-butenyl)-1,16-didehydro-1,2-dihydro-psi,psi-carotene. Its biosynthetic pathway highlights the intricate biochemical processes that contribute to the diversity of carotenoid compounds. Nonaflavuxanthin, along with its derivatives, is of interest not only for its role in plant biology but also for its potential applications in nutrition and medicine due to its antioxidant properties (PMID:11511870 ). Understanding the chemistry and biology of nonaflavuxanthin can provide insights into its functional significance in various organisms and its potential benefits in human health.
Structure
SynonymsNot Available
Molecular FormulaC45H64O
Average Mass621.006
Monoisotopic Mass620.495716681
IUPAC Name(2E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,28E)-2,8,12,16,21,25,29,33-octamethyl-5-(prop-1-en-2-yl)tetratriaconta-2,8,10,12,14,16,18,20,22,24,26,28,32-tridecaen-1-ol
Traditional Name(2E,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E,28E)-2,8,12,16,21,25,29,33-octamethyl-5-(prop-1-en-2-yl)tetratriaconta-2,8,10,12,14,16,18,20,22,24,26,28,32-tridecaen-1-ol
CAS Registry NumberNot Available
SMILES
[H]\C(CC(CC\C(C)=C(/[H])\C(\[H])=C(/[H])\C(\C)=C(/[H])\C(\[H])=C(/[H])\C(\C)=C(/[H])\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)\C(\[H])=C(/[H])\C(\[H])=C(/C)CCC=C(C)C)C(C)=C)=C(\C)CO
InChI Identifier
InChI=1S/C45H64O/c1-36(2)19-14-22-40(7)25-17-28-41(8)26-15-23-38(5)20-12-13-21-39(6)24-16-27-42(9)29-18-30-43(10)31-33-45(37(3)4)34-32-44(11)35-46/h12-13,15-21,23-30,32,45-46H,3,14,22,31,33-35H2,1-2,4-11H3/b13-12+,23-15+,24-16+,28-17+,29-18+,38-20+,39-21+,40-25+,41-26+,42-27+,43-30+,44-32+
InChI KeyDVCGBQVEWVCRNX-WJDABEKTSA-N