Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-04-29 22:45:26 UTC
Update Date2025-10-07 16:08:14 UTC
Metabolite IDMMDBc0049880
Metabolite Identification
Common Name2-Hydroxyglutaryl-CoA
Description2-Hydroxyglutaryl-CoA is a thioester metabolite belonging to the class of CoA derivatives. Its chemical structure features a hydroxy group at the second carbon of the glutaryl moiety, which is crucial for its biochemical reactivity. This compound plays a significant role in anaerobic metabolic pathways, particularly in the gut microbiome, where it is involved in the degradation of 4-hydroxynonanedioic acid through β-oxidation, leading to the formation of 2-ketoglutaric acid that enters the citric acid cycle (PMID:25274632 ). The enzyme 2-hydroxyglutaryl-CoA dehydratase, derived from Clostridium symbiosum, catalyzes the reversible dehydration of (R)-2-hydroxyglutaryl-CoA to (E)-glutaconyl-CoA, highlighting its importance in metabolic conversions (PMID:21434666 ). Additionally, the enzyme's structure is related to the ASKHA superfamily of phosphotransferases, sharing a common fold with pantothenate kinase (PMID:24311585 ). Its substrate specificity and the role in producing bio-based compounds like adipic acid further emphasize its relevance in biotechnological applications (PMID:21434666 ). The unique properties of 2-hydroxyglutaryl-CoA and its associated enzymes underscore its significance in microbial metabolism and potential industrial uses.
Structure
Synonyms
ValueSource
2-Hydroxyglutaryl-coenzyme AChEBI
Molecular FormulaC26H42N7O20P3S
Average Mass897.63
Monoisotopic Mass897.141818948
IUPAC Name5-[(2-{3-[(2R)-3-[({[({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)methyl]-2-hydroxy-3-methylbutanamido]propanamido}ethyl)sulfanyl]-4-hydroxy-5-oxopentanoic acid
Traditional Name2-hydroxyglutaryl-coa
CAS Registry NumberNot Available
SMILES
CC(C)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP(O)(O)=O)N1C=NC2=C1N=CN=C2N)[C@@H](O)C(=O)NCCC(=O)NCCSC(=O)C(O)CCC(O)=O
InChI Identifier
InChI=1S/C26H42N7O20P3S/c1-26(2,20(39)23(40)29-6-5-15(35)28-7-8-57-25(41)13(34)3-4-16(36)37)10-50-56(47,48)53-55(45,46)49-9-14-19(52-54(42,43)44)18(38)24(51-14)33-12-32-17-21(27)30-11-31-22(17)33/h11-14,18-20,24,34,38-39H,3-10H2,1-2H3,(H,28,35)(H,29,40)(H,36,37)(H,45,46)(H,47,48)(H2,27,30,31)(H2,42,43,44)/t13?,14-,18-,19-,20+,24-/m1/s1
InChI KeyITRSBJZNLOYNNR-RMNRSTNRSA-N