Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 22:56:08 UTC
Update Date2025-10-07 16:08:23 UTC
Metabolite IDMMDBc0054151
Metabolite Identification
Common Name1D-myo-inositol 3-phosphate
Description1D-myo-inositol 3-phosphate is a polyol and a member of the inositol phosphate class, which plays a crucial role in various cellular signaling pathways. Chemically, it is characterized by a six-carbon sugar structure with multiple hydroxyl groups, specifically phosphorylated at the 3-position, contributing to its reactivity and involvement in metabolic processes. It serves as a precursor in the biosynthesis of inositol phosphates and is generated from myo-inositol through the action of the enzyme 1D-myo-inositol 3-phosphate synthase (EC 5.5.1.4), which catalyzes the first step in myo-inositol biosynthesis and directs phytic acid biosynthesis in seeds (PMID:19021878 ). Additionally, 1D-myo-inositol 3-phosphate is implicated in lipid metabolism, as evidenced by its association with 1-phosphatidyl-1D-myo-inositol 3-phosphate (PI(3)P) levels under specific conditions (PMID:37315361 ). It is also involved in a phosphorylation pathway that operates independently of inositol lipids, highlighting its versatility in cellular signaling (PMID:17961936 ). The structural characterization of its complexes, such as with the TK2285 protein, further elucidates its biochemical interactions (PMID:25972008 ).
Structure
Synonyms
ValueSource
1D-Myo-inositol 3-phosphoric acidGenerator
1D-Myo-inositol 3-monophosphateHMDB
1l-Myo-inositol 1-phosphateHMDB
D-Myo-inositol 3-monophosphateHMDB
D-Myo-inositol 3-phosphateHMDB
Inositol 3-monophosphateHMDB
Inositol 3-phosphateHMDB
L-Myo-inositol 1-phosphateHMDB
Myo-inositol 3-monophosphateHMDB
Myo-inositol 3-phosphateHMDB
D-Myo-inositol-3-phosphateHMDB
Inositol 3-phosphate, (-)-isomerHMDB
Myoinositol 3-phosphateHMDB
Molecular FormulaC6H13O9P
Average Mass260.1358
Monoisotopic Mass260.029718526
IUPAC Name{[(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]oxy}phosphonic acid
Traditional Name[(2S,3R,5S,6S)-2,3,4,5,6-pentahydroxycyclohexyl]oxyphosphonic acid
CAS Registry NumberNot Available
SMILES
OC1[C@H](O)[C@H](O)C(OP(O)(O)=O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C6H13O9P/c7-1-2(8)4(10)6(5(11)3(1)9)15-16(12,13)14/h1-11H,(H2,12,13,14)/t1?,2-,3+,4-,5-,6?/m0/s1
InChI KeyINAPMGSXUVUWAF-LXOASSSBSA-N