Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-06-05 23:03:24 UTC
Update Date2025-10-07 16:08:27 UTC
Metabolite IDMMDBc0054274
Metabolite Identification
Common Name4-methoxybenzoic acid
Description4-methoxybenzoic acid is a phenolic acid that belongs to the class of aromatic carboxylic acids. Its chemical structure features a methoxy group (-OCH3) at the para position relative to the carboxylic acid (-COOH) group on a benzene ring. This compound has been identified as a relevant metabolite in various biochemical pathways. For instance, it is involved in the synthesis of related compounds such as 3-hydroxy-4-methoxybenzoic acid and 4-methoxycinnamic acid, which are highlighted in studies focusing on metabolic profiling (PMID:40284247 ). Additionally, 4-methoxybenzoic acid has been utilized in the development of self-doping conductive biomaterials, demonstrating its potential in biomedical applications, such as improving cardiac electrical conduction (PMID:40023467 ). It also plays a role in the synthesis of polymeric materials, where it can be grafted onto gelatin to enhance material properties (PMID:39577481 ). Furthermore, its derivatives, such as 4-methoxybenzoic acid-3-sulfate, are included in metabolic signatures, indicating its significance in metabolic pathways (PMID:39604558 ). Overall, 4-methoxybenzoic acid serves as a versatile compound in both chemical synthesis and biological contexts.
Structure
Synonyms
ValueSource
p-MethoxybenzoateChEBI
p-Methoxybenzoic acidGenerator
4-Methoxybenzoic acidGenerator
p-Anisic acidMeSH
4-Anisic acid, potassium saltMeSH
4-Anisic acidMeSH
4-Anisic acid, sodium saltMeSH
4-Anisic acid, copper (+2) saltMeSH
4-Anisic acid, 14C-carboxyMeSH
Para-anisic acidMeSH
Molecular FormulaC8H7O3
Average Mass151.142
Monoisotopic Mass151.040067665
IUPAC Name4-methoxybenzoate
Traditional Name4-methoxybenzoate
CAS Registry NumberNot Available
SMILES
COC1=CC=C(C=C1)C([O-])=O
InChI Identifier
InChI=1S/C8H8O3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3,(H,9,10)/p-1
InChI KeyZEYHEAKUIGZSGI-UHFFFAOYSA-M