Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-10-17 17:52:31 UTC
Update Date2025-10-07 16:09:49 UTC
Metabolite IDMMDBc0057105
Metabolite Identification
Common Name3-Hydroxydodecanoyl-CoA
Description3-Hydroxydodecanoyl-CoA is a fatty acyl-CoA derivative, classified as a medium-chain acyl-CoA compound. Its chemical structure features a 12-carbon dodecanoyl chain with a hydroxyl group at the third carbon, which contributes to its reactivity and role in metabolic pathways. This compound is involved in various biochemical processes, particularly in the metabolism of fatty acids. It serves as a substrate for enzymes in the mitochondrial β-oxidation pathway, where it is broken down to generate energy. Additionally, 3-hydroxydodecanoyl-CoA has been shown to support measurable rates of enzyme activity, indicating its functional importance in metabolic pathways (PMID:2872920 ). This metabolite plays a role in the synthesis and degradation of fatty acids, influencing lipid metabolism and energy production in cells. Its presence and activity are crucial for maintaining metabolic homeostasis, particularly in tissues that rely heavily on fatty acid oxidation for energy, such as muscle and liver.
Structure
SynonymsNot Available
Molecular FormulaC33H54N7O18P3S
Average Mass961.81
Monoisotopic Mass961.248084414
IUPAC Name(3R)-3-hydroxy-3-{[2-({2-[(3-hydroxydodecanoyl)sulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}-2,2-dimethylpropyl ({[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methyl phosphono}oxy)phosphonate
Traditional Name(3R)-3-hydroxy-3-{[2-({2-[(3-hydroxydodecanoyl)sulfanyl]ethyl}carbamoyl)ethyl]carbamoyl}-2,2-dimethylpropyl {[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]methyl phosphono}oxyphosphonate
CAS Registry NumberNot Available
SMILES
CCCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OC[C@H]1O[C@H]([C@H](O)[C@@H]1OP([O-])([O-])=O)N1C=NC2=C1N=CN=C2N
InChI Identifier
InChI=1S/C33H58N7O18P3S/c1-4-5-6-7-8-9-10-11-21(41)16-24(43)62-15-14-35-23(42)12-13-36-31(46)28(45)33(2,3)18-55-61(52,53)58-60(50,51)54-17-22-27(57-59(47,48)49)26(44)32(56-22)40-20-39-25-29(34)37-19-38-30(25)40/h19-22,26-28,32,41,44-45H,4-18H2,1-3H3,(H,35,42)(H,36,46)(H,50,51)(H,52,53)(H2,34,37,38)(H2,47,48,49)/p-4/t21?,22-,26-,27-,28+,32-/m1/s1
InChI KeyIJFLXRCJWPKGKJ-XIRPNGCASA-J