Microbial
Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-11-10 16:35:35 UTC
Update Date2025-10-07 16:09:57 UTC
Metabolite IDMMDBc0057212
Metabolite Identification
Common NameL-Argininyl-L-leucine
DescriptionL-Argininyl-L-leucine is a dipeptide belonging to the class of amino acid derivatives. Its chemical structure comprises the amino acids L-arginine and L-leucine linked by a peptide bond, which influences its properties and biological activity. This compound is involved in various metabolic pathways, particularly those related to amino acid transport and metabolism. For instance, studies have shown that L-argininyl-L-leucine exhibits 38% of the effectiveness of L-arginine in certain biological contexts (PMID:9872589 ). Additionally, research on HD11 cells indicates that both L-argininyl-L-leucine and its counterpart L-leucinyl-L-arginine can inhibit arginine uptake when tested in Hanks Balanced Salts solution (PMID:9872589 ). This suggests that L-argininyl-L-leucine may play a role in modulating arginine transport mechanisms, which are critical for various physiological processes, including nitric oxide synthesis and the regulation of metabolic pathways involving arginine and leucine. Understanding the chemistry and transport dynamics of L-argininyl-L-leucine can provide insights into its potential roles in metabolic regulation and cellular function.
Structure
Synonyms
ValueSource
Arginyl-leucineChEBI
L-Arg-L-leuChEBI
RLChEBI
Arg-leuHMDB
Arginine leucine dipeptideHMDB
Arginine-leucine dipeptideHMDB
L-Arginyl-L-leucineHMDB
N-ArginylleucineHMDB
N-L-Arginyl-L-leucineHMDB
R-L DipeptideHMDB
RL DipeptideHMDB
ArginylleucineChEBI
Molecular FormulaC12H25N5O3
Average Mass287.364
Monoisotopic Mass287.195739685
IUPAC Name(2S)-2-[(2S)-2-amino-5-carbamimidamidopentanamido]-4-methylpentanoic acid
Traditional Name(2S)-2-[(2S)-2-amino-5-carbamimidamidopentanamido]-4-methylpentanoic acid
CAS Registry NumberNot Available
SMILES
CC(C)C[C@H](NC(=O)[C@@H](N)CCCNC(N)=N)C(O)=O
InChI Identifier
InChI=1S/C12H25N5O3/c1-7(2)6-9(11(19)20)17-10(18)8(13)4-3-5-16-12(14)15/h7-9H,3-6,13H2,1-2H3,(H,17,18)(H,19,20)(H4,14,15,16)/t8-,9-/m0/s1
InChI KeyWYBVBIHNJWOLCJ-IUCAKERBSA-N