Record Information
Version2.0
StatusDetected and Quantified
Creation Date2022-11-10 16:35:42 UTC
Update Date2025-10-07 16:09:57 UTC
Metabolite IDMMDBc0057213
Metabolite Identification
Common NameUridine 3',5'-phosphate
DescriptionUridine 3',5'-phosphate is a cyclic nucleotide belonging to the class of phosphates, specifically a cyclic nucleotide phosphate. Its chemical structure features a uridine base linked to a phosphate group through a phosphodiester bond, forming a cyclic arrangement that is crucial for its biological activity. This compound plays a role in various cellular signaling pathways, particularly those involving the regulation of phosphodiesterases, which are enzymes that hydrolyze cyclic nucleotides. For instance, a cyclic 3',5'-nucleotide phosphodiesterase has been identified in the heart that exhibits specificity for uridine 3',5'-phosphate, highlighting its importance in cardiac function and signaling (PMID:4284419 ). The cyclic nature of uridine 3',5'-phosphate allows it to participate in the modulation of intracellular processes, influencing various physiological responses. Its involvement in these pathways underscores the significance of cyclic nucleotides in cellular communication and regulation.
Structure
Synonyms
ValueSource
Uridine 3',5'-bis(dihydrogen phosphoric acid)Generator
{[(2R,3S,4R,5R)-4-hydroxy-5-(4-hydroxy-2-oxo-1,2-dihydropyrimidin-1-yl)-3-(phosphonooxy)oxolan-2-yl]methoxy}phosphonateGenerator
Molecular FormulaC9H14N2O12P2
Average Mass404.1612
Monoisotopic Mass404.002196946
IUPAC Name{[(2R,3S,4R,5R)-4-hydroxy-5-(4-hydroxy-2-oxo-1,2-dihydropyrimidin-1-yl)-2-[(phosphonooxy)methyl]oxolan-3-yl]oxy}phosphonic acid
Traditional Name[(2R,3S,4R,5R)-4-hydroxy-5-(4-hydroxy-2-oxopyrimidin-1-yl)-2-[(phosphonooxy)methyl]oxolan-3-yl]oxyphosphonic acid
CAS Registry NumberNot Available
SMILES
[H][C@]1(COP(O)(O)=O)O[C@@]([H])(N2C=CC(O)=NC2=O)[C@]([H])(O)[C@]1([H])OP(O)(O)=O
InChI Identifier
InChI=1S/C9H14N2O12P2/c12-5-1-2-11(9(14)10-5)8-6(13)7(23-25(18,19)20)4(22-8)3-21-24(15,16)17/h1-2,4,6-8,13H,3H2,(H,10,12,14)(H2,15,16,17)(H2,18,19,20)/t4-,6-,7-,8-/m1/s1
InChI KeyZPVPRWPOZBXDKD-XVFCMESISA-N